C22H35NO4S — CID 58145236
N-tert-butyl-4-(7-tert-butylsulfonyl-2-oxoheptyl)benzamide (PubChem CID 58145236) has the molecular formula C22H35NO4S and a molecular weight of 409.59 g/mol. Its IUPAC name is N-tert-butyl-4-(7-tert-butylsulfonyl-2-oxoheptyl)benzamide.
| Compound Name | N-tert-butyl-4-(7-tert-butylsulfonyl-2-oxoheptyl)benzamide |
|---|---|
| PubChem CID | 58145236 |
| Molecular Formula | C22H35NO4S |
| Molecular Weight | 409.59 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | N-tert-butyl-4-(7-tert-butylsulfonyl-2-oxoheptyl)benzamide |
| SMILES | CC(C)(C)NC(=O)c1ccc(CC(=O)CCCCCS(=O)(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H35NO4S/c1-21(2,3)23-20(25)18-13-11-17(12-14-18)16-19(24)10-8-7-9-15-28(26,27)22(4,5)6/h11-14H,7-10,15-16H2,1-6H3,(H,23,25) |
| InChIKey | VLLWTHOBZMGODJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.59 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|