C19H31NO5S2 — CID 58145480
4-(2-oxo-7-propan-2-ylsulfonylheptyl)-N-propan-2-ylbenzenesulfonamide (PubChem CID 58145480) has the molecular formula C19H31NO5S2 and a molecular weight of 417.59 g/mol. Its IUPAC name is 4-(2-oxo-7-propan-2-ylsulfonylheptyl)-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 4-(2-oxo-7-propan-2-ylsulfonylheptyl)-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 58145480 |
| Molecular Formula | C19H31NO5S2 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 4-(2-oxo-7-propan-2-ylsulfonylheptyl)-N-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(CC(=O)CCCCCS(=O)(=O)C(C)C)cc1 |
| InChI | InChI=1S/C19H31NO5S2/c1-15(2)20-27(24,25)19-11-9-17(10-12-19)14-18(21)8-6-5-7-13-26(22,23)16(3)4/h9-12,15-16,20H,5-8,13-14H2,1-4H3 |
| InChIKey | CUSRTPADXXNHCF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|