C21H31NO3S — CID 58143978
1-[4-(3,6-dihydro-2H-pyridin-1-yl)phenyl]-7-propan-2-ylsulfonylheptan-2-one (PubChem CID 58143978) has the molecular formula C21H31NO3S and a molecular weight of 377.55 g/mol. Its IUPAC name is 1-[4-(3,6-dihydro-2H-pyridin-1-yl)phenyl]-7-propan-2-ylsulfonylheptan-2-one.
| Compound Name | 1-[4-(3,6-dihydro-2H-pyridin-1-yl)phenyl]-7-propan-2-ylsulfonylheptan-2-one |
|---|---|
| PubChem CID | 58143978 |
| Molecular Formula | C21H31NO3S |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 1-[4-(3,6-dihydro-2H-pyridin-1-yl)phenyl]-7-propan-2-ylsulfonylheptan-2-one |
| SMILES | CC(C)S(=O)(=O)CCCCCC(=O)Cc1ccc(N2CC=CCC2)cc1 |
| InChI | InChI=1S/C21H31NO3S/c1-18(2)26(24,25)16-8-3-5-9-21(23)17-19-10-12-20(13-11-19)22-14-6-4-7-15-22/h4,6,10-13,18H,3,5,7-9,14-17H2,1-2H3 |
| InChIKey | KJFMNWNZWFJTOS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|