C19H27F3O3S — CID 58145511
1-[3-ethyl-4-(trifluoromethyl)phenyl]-7-propan-2-ylsulfonylheptan-2-one (PubChem CID 58145511) has the molecular formula C19H27F3O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is 1-[3-ethyl-4-(trifluoromethyl)phenyl]-7-propan-2-ylsulfonylheptan-2-one.
| Compound Name | 1-[3-ethyl-4-(trifluoromethyl)phenyl]-7-propan-2-ylsulfonylheptan-2-one |
|---|---|
| PubChem CID | 58145511 |
| Molecular Formula | C19H27F3O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 1-[3-ethyl-4-(trifluoromethyl)phenyl]-7-propan-2-ylsulfonylheptan-2-one |
| SMILES | CCc1cc(CC(=O)CCCCCS(=O)(=O)C(C)C)ccc1C(F)(F)F |
| InChI | InChI=1S/C19H27F3O3S/c1-4-16-12-15(9-10-18(16)19(20,21)22)13-17(23)8-6-5-7-11-26(24,25)14(2)3/h9-10,12,14H,4-8,11,13H2,1-3H3 |
| InChIKey | VZCKKCGECHUFHZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|