C21H32O3S — CID 58144332
1-(1,7-dimethyl-2,3-dihydro-1H-inden-5-yl)-7-propan-2-ylsulfonylheptan-2-one (PubChem CID 58144332) has the molecular formula C21H32O3S and a molecular weight of 364.55 g/mol. Its IUPAC name is 1-(1,7-dimethyl-2,3-dihydro-1H-inden-5-yl)-7-propan-2-ylsulfonylheptan-2-one.
| Compound Name | 1-(1,7-dimethyl-2,3-dihydro-1H-inden-5-yl)-7-propan-2-ylsulfonylheptan-2-one |
|---|---|
| PubChem CID | 58144332 |
| Molecular Formula | C21H32O3S |
| Molecular Weight | 364.55 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | 1-(1,7-dimethyl-2,3-dihydro-1H-inden-5-yl)-7-propan-2-ylsulfonylheptan-2-one |
| SMILES | Cc1cc(CC(=O)CCCCCS(=O)(=O)C(C)C)cc2c1C(C)CC2 |
| InChI | InChI=1S/C21H32O3S/c1-15(2)25(23,24)11-7-5-6-8-20(22)14-18-12-17(4)21-16(3)9-10-19(21)13-18/h12-13,15-16H,5-11,14H2,1-4H3 |
| InChIKey | ZVCYKGKNRSXORW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|