C22H28O4S — CID 58145546
1-(4-phenoxyphenyl)-7-propan-2-ylsulfonylheptan-2-one (PubChem CID 58145546) has the molecular formula C22H28O4S and a molecular weight of 388.53 g/mol. Its IUPAC name is 1-(4-phenoxyphenyl)-7-propan-2-ylsulfonylheptan-2-one.
| Compound Name | 1-(4-phenoxyphenyl)-7-propan-2-ylsulfonylheptan-2-one |
|---|---|
| PubChem CID | 58145546 |
| Molecular Formula | C22H28O4S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 1-(4-phenoxyphenyl)-7-propan-2-ylsulfonylheptan-2-one |
| SMILES | CC(C)S(=O)(=O)CCCCCC(=O)Cc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C22H28O4S/c1-18(2)27(24,25)16-8-4-5-9-20(23)17-19-12-14-22(15-13-19)26-21-10-6-3-7-11-21/h3,6-7,10-15,18H,4-5,8-9,16-17H2,1-2H3 |
| InChIKey | ZXCYOEZAUFDRST-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|