C19H27FO3S — CID 58144512
1-(2-fluoro-2,3-dihydro-1H-inden-5-yl)-7-propan-2-ylsulfonylheptan-2-one (PubChem CID 58144512) has the molecular formula C19H27FO3S and a molecular weight of 354.49 g/mol. Its IUPAC name is 1-(2-fluoro-2,3-dihydro-1H-inden-5-yl)-7-propan-2-ylsulfonylheptan-2-one.
| Compound Name | 1-(2-fluoro-2,3-dihydro-1H-inden-5-yl)-7-propan-2-ylsulfonylheptan-2-one |
|---|---|
| PubChem CID | 58144512 |
| Molecular Formula | C19H27FO3S |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 1-(2-fluoro-2,3-dihydro-1H-inden-5-yl)-7-propan-2-ylsulfonylheptan-2-one |
| SMILES | CC(C)S(=O)(=O)CCCCCC(=O)Cc1ccc2c(c1)CC(F)C2 |
| InChI | InChI=1S/C19H27FO3S/c1-14(2)24(22,23)9-5-3-4-6-19(21)11-15-7-8-16-12-18(20)13-17(16)10-15/h7-8,10,14,18H,3-6,9,11-13H2,1-2H3 |
| InChIKey | UAMNXGDXTNNQCO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|