C19H29FO2S — CID 59549855
2-fluoro-5-(7-propan-2-ylsulfonylheptyl)-2,3-dihydro-1H-indene (PubChem CID 59549855) has the molecular formula C19H29FO2S and a molecular weight of 340.50 g/mol. Its IUPAC name is 2-fluoro-5-(7-propan-2-ylsulfonylheptyl)-2,3-dihydro-1H-indene.
| Compound Name | 2-fluoro-5-(7-propan-2-ylsulfonylheptyl)-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 59549855 |
| Molecular Formula | C19H29FO2S |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 2-fluoro-5-(7-propan-2-ylsulfonylheptyl)-2,3-dihydro-1H-indene |
| SMILES | CC(C)S(=O)(=O)CCCCCCCc1ccc2c(c1)CC(F)C2 |
| InChI | InChI=1S/C19H29FO2S/c1-15(2)23(21,22)11-7-5-3-4-6-8-16-9-10-17-13-19(20)14-18(17)12-16/h9-10,12,15,19H,3-8,11,13-14H2,1-2H3 |
| InChIKey | QJRNULYSALIYCT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|