C19H27NO3S — CID 158606349
5-[4-(7-propan-2-ylsulfonylheptyl)phenyl]-1,2-oxazole (PubChem CID 158606349) has the molecular formula C19H27NO3S and a molecular weight of 349.50 g/mol. Its IUPAC name is 5-[4-(7-propan-2-ylsulfonylheptyl)phenyl]-1,2-oxazole.
| Compound Name | 5-[4-(7-propan-2-ylsulfonylheptyl)phenyl]-1,2-oxazole |
|---|---|
| PubChem CID | 158606349 |
| Molecular Formula | C19H27NO3S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 5-[4-(7-propan-2-ylsulfonylheptyl)phenyl]-1,2-oxazole |
| SMILES | CC(C)S(=O)(=O)CCCCCCCc1ccc(-c2ccno2)cc1 |
| InChI | InChI=1S/C19H27NO3S/c1-16(2)24(21,22)15-7-5-3-4-6-8-17-9-11-18(12-10-17)19-13-14-20-23-19/h9-14,16H,3-8,15H2,1-2H3 |
| InChIKey | WFXCYCNPPNZSIO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|