C21H36N2O3S — CID 160858579
(2R,6R)-2,6-dimethyl-4-[5-(7-propan-2-ylsulfonylheptyl)-2-pyridinyl]morpholine (PubChem CID 160858579) has the molecular formula C21H36N2O3S and a molecular weight of 396.60 g/mol. Its IUPAC name is (2R,6R)-2,6-dimethyl-4-[5-(7-propan-2-ylsulfonylheptyl)-2-pyridinyl]morpholine.
| Compound Name | (2R,6R)-2,6-dimethyl-4-[5-(7-propan-2-ylsulfonylheptyl)-2-pyridinyl]morpholine |
|---|---|
| PubChem CID | 160858579 |
| Molecular Formula | C21H36N2O3S |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | (2R,6R)-2,6-dimethyl-4-[5-(7-propan-2-ylsulfonylheptyl)-2-pyridinyl]morpholine |
| SMILES | CC(C)S(=O)(=O)CCCCCCCc1ccc(N2C[C@@H](C)O[C@H](C)C2)nc1 |
| InChI | InChI=1S/C21H36N2O3S/c1-17(2)27(24,25)13-9-7-5-6-8-10-20-11-12-21(22-14-20)23-15-18(3)26-19(4)16-23/h11-12,14,17-19H,5-10,13,15-16H2,1-4H3/t18-,19-/m1/s1 |
| InChIKey | CDYWTLDIRIZXES-RTBURBONSA-N |
| XLogP | 4.01 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|