C15H24N2O — CID 71155007
(2S,6R)-4-(5-butan-2-yl-2-pyridinyl)-2,6-dimethylmorpholine (PubChem CID 71155007) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is (2S,6R)-4-(5-butan-2-yl-2-pyridinyl)-2,6-dimethylmorpholine.
| Compound Name | (2S,6R)-4-(5-butan-2-yl-2-pyridinyl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 71155007 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | (2S,6R)-4-(5-butan-2-yl-2-pyridinyl)-2,6-dimethylmorpholine |
| SMILES | CCC(C)c1ccc(N2C[C@@H](C)O[C@@H](C)C2)nc1 |
| InChI | InChI=1S/C15H24N2O/c1-5-11(2)14-6-7-15(16-8-14)17-9-12(3)18-13(4)10-17/h6-8,11-13H,5,9-10H2,1-4H3/t11?,12-,13+ |
| InChIKey | NKRDZLQKOXLLSU-YHWZYXNKSA-N |
| XLogP | 3.21 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |