C15H24N2O — CID 114066341
(1R)-1-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]propan-1-amine (PubChem CID 114066341) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is (1R)-1-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]propan-1-amine.
| Compound Name | (1R)-1-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]propan-1-amine |
|---|---|
| PubChem CID | 114066341 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | (1R)-1-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]propan-1-amine |
| SMILES | CC[C@@H](N)c1ccc(N2C[C@@H](C)O[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C15H24N2O/c1-4-15(16)13-5-7-14(8-6-13)17-9-11(2)18-12(3)10-17/h5-8,11-12,15H,4,9-10,16H2,1-3H3/t11-,12+,15-/m1/s1 |
| InChIKey | NDTPNVPEUYNSCV-TYNCELHUSA-N |
| XLogP | 2.71 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|