About (2R)-2,6-dimethyl-4-(5-methyl-2-pyridinyl)morpholine
(2R)-2,6-dimethyl-4-(5-methyl-2-pyridinyl)morpholine (PubChem CID 143577570) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is (2R)-2,6-dimethyl-4-(5-methyl-2-pyridinyl)morpholine.
Molecular Properties
| Compound Name | (2R)-2,6-dimethyl-4-(5-methyl-2-pyridinyl)morpholine |
| PubChem CID | 143577570 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | (2R)-2,6-dimethyl-4-(5-methyl-2-pyridinyl)morpholine |
| SMILES | Cc1ccc(N2CC(C)O[C@H](C)C2)nc1 |
| InChI | InChI=1S/C12H18N2O/c1-9-4-5-12(13-6-9)14-7-10(2)15-11(3)8-14/h4-6,10-11H,7-8H2,1-3H3/t10-,11?/m1/s1 |
| InChIKey | XIPUTLYDJYIDID-NFJWQWPMSA-N |
| XLogP | 2.00 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2,6-dimethyl-4-(5-methyl-2-pyridinyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2,6-dimethyl-4-(5-methyl-2-pyridinyl)morpholine?
The IUPAC name of (2R)-2,6-dimethyl-4-(5-methyl-2-pyridinyl)morpholine (CID 143577570) is (2R)-2,6-dimethyl-4-(5-methyl-2-pyridinyl)morpholine.
What is the SMILES notation for (2R)-2,6-dimethyl-4-(5-methyl-2-pyridinyl)morpholine?
The canonical SMILES for (2R)-2,6-dimethyl-4-(5-methyl-2-pyridinyl)morpholine is Cc1ccc(N2CC(C)O[C@H](C)C2)nc1.
What is the InChIKey of (2R)-2,6-dimethyl-4-(5-methyl-2-pyridinyl)morpholine?
The InChIKey is XIPUTLYDJYIDID-NFJWQWPMSA-N. The full InChI is InChI=1S/C12H18N2O/c1-9-4-5-12(13-6-9)14-7-10(2)15-11(3)8-14/h4-6,10-11H,7-8H2,1-3H3/t10-,11?/m1/s1.
What are the key properties of (2R)-2,6-dimethyl-4-(5-methyl-2-pyridinyl)morpholine?
(2R)-2,6-dimethyl-4-(5-methyl-2-pyridinyl)morpholine has a molecular weight of 206.29 g/mol, XLogP of 2.00, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2,6-dimethyl-4-(5-methyl-2-pyridinyl)morpholine is sourced from PubChem (CID 143577570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).