C23H39NO3S — CID 59546095
(2R,6S)-4-[4-(7-tert-butylsulfonylheptyl)phenyl]-2,6-dimethylmorpholine (PubChem CID 59546095) has the molecular formula C23H39NO3S and a molecular weight of 409.64 g/mol. Its IUPAC name is (2R,6S)-4-[4-(7-tert-butylsulfonylheptyl)phenyl]-2,6-dimethylmorpholine.
| Compound Name | (2R,6S)-4-[4-(7-tert-butylsulfonylheptyl)phenyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 59546095 |
| Molecular Formula | C23H39NO3S |
| Molecular Weight | 409.64 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | (2R,6S)-4-[4-(7-tert-butylsulfonylheptyl)phenyl]-2,6-dimethylmorpholine |
| SMILES | C[C@@H]1CN(c2ccc(CCCCCCCS(=O)(=O)C(C)(C)C)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C23H39NO3S/c1-19-17-24(18-20(2)27-19)22-14-12-21(13-15-22)11-9-7-6-8-10-16-28(25,26)23(3,4)5/h12-15,19-20H,6-11,16-18H2,1-5H3/t19-,20+ |
| InChIKey | HOSTZJIXRLBPAA-BGYRXZFFSA-N |
| XLogP | 5.01 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.64 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|