C23H33N3O3S — CID 118376755
N-[4-[[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]anilino]methyl]phenyl]-2-methylpropane-2-sulfonamide (PubChem CID 118376755) has the molecular formula C23H33N3O3S and a molecular weight of 431.60 g/mol. Its IUPAC name is N-[4-[[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]anilino]methyl]phenyl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[4-[[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]anilino]methyl]phenyl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 118376755 |
| Molecular Formula | C23H33N3O3S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | N-[4-[[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]anilino]methyl]phenyl]-2-methylpropane-2-sulfonamide |
| SMILES | C[C@@H]1CN(c2ccc(NCc3ccc(NS(=O)(=O)C(C)(C)C)cc3)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C23H33N3O3S/c1-17-15-26(16-18(2)29-17)22-12-10-20(11-13-22)24-14-19-6-8-21(9-7-19)25-30(27,28)23(3,4)5/h6-13,17-18,24-25H,14-16H2,1-5H3/t17-,18+ |
| InChIKey | GKKSEFRGUMZHJF-HDICACEKSA-N |
| XLogP | 4.45 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|