C24H35N3O2S — CID 118376615
N-[4-[[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]anilino]methyl]phenyl]-2-methylpropane-2-sulfonamide (PubChem CID 118376615) has the molecular formula C24H35N3O2S and a molecular weight of 429.63 g/mol. Its IUPAC name is N-[4-[[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]anilino]methyl]phenyl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[4-[[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]anilino]methyl]phenyl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 118376615 |
| Molecular Formula | C24H35N3O2S |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | N-[4-[[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]anilino]methyl]phenyl]-2-methylpropane-2-sulfonamide |
| SMILES | C[C@@H]1C[C@H](C)CN(c2ccc(NCc3ccc(NS(=O)(=O)C(C)(C)C)cc3)cc2)C1 |
| InChI | InChI=1S/C24H35N3O2S/c1-18-14-19(2)17-27(16-18)23-12-10-21(11-13-23)25-15-20-6-8-22(9-7-20)26-30(28,29)24(3,4)5/h6-13,18-19,25-26H,14-17H2,1-5H3/t18-,19+ |
| InChIKey | KBDMDTUMRZLAAH-KDURUIRLSA-N |
| XLogP | 5.32 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|