C21H27ClN2 — CID 110823411
N-[(4-chlorophenyl)methyl]-1-[4-(3,5-dimethylpiperidin-1-yl)phenyl]methanamine (PubChem CID 110823411) has the molecular formula C21H27ClN2 and a molecular weight of 342.91 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-1-[4-(3,5-dimethylpiperidin-1-yl)phenyl]methanamine.
| Compound Name | N-[(4-chlorophenyl)methyl]-1-[4-(3,5-dimethylpiperidin-1-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 110823411 |
| Molecular Formula | C21H27ClN2 |
| Molecular Weight | 342.91 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-1-[4-(3,5-dimethylpiperidin-1-yl)phenyl]methanamine |
| SMILES | CC1CC(C)CN(c2ccc(CNCc3ccc(Cl)cc3)cc2)C1 |
| InChI | InChI=1S/C21H27ClN2/c1-16-11-17(2)15-24(14-16)21-9-5-19(6-10-21)13-23-12-18-3-7-20(22)8-4-18/h3-10,16-17,23H,11-15H2,1-2H3 |
| InChIKey | VBOXSBIEFSAOIT-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.91 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|