C13H20N2O2 — CID 106670405
1-[4-(ethylaminomethyl)phenyl]pyrrolidine-3,4-diol (PubChem CID 106670405) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-[4-(ethylaminomethyl)phenyl]pyrrolidine-3,4-diol.
| Compound Name | 1-[4-(ethylaminomethyl)phenyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106670405 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 1-[4-(ethylaminomethyl)phenyl]pyrrolidine-3,4-diol |
| SMILES | CCNCc1ccc(N2CC(O)C(O)C2)cc1 |
| InChI | InChI=1S/C13H20N2O2/c1-2-14-7-10-3-5-11(6-4-10)15-8-12(16)13(17)9-15/h3-6,12-14,16-17H,2,7-9H2,1H3 |
| InChIKey | GNDSVIXMZULPEN-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|