C25H33NO4S — CID 58144957
1-[4-(tert-butylsulfonylmethyl)phenyl]-2-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]phenyl]ethanone (PubChem CID 58144957) has the molecular formula C25H33NO4S and a molecular weight of 443.61 g/mol. Its IUPAC name is 1-[4-(tert-butylsulfonylmethyl)phenyl]-2-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]phenyl]ethanone.
| Compound Name | 1-[4-(tert-butylsulfonylmethyl)phenyl]-2-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 58144957 |
| Molecular Formula | C25H33NO4S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 1-[4-(tert-butylsulfonylmethyl)phenyl]-2-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]phenyl]ethanone |
| SMILES | C[C@@H]1CN(c2ccc(CC(=O)c3ccc(CS(=O)(=O)C(C)(C)C)cc3)cc2)C[C@@H](C)O1 |
| InChI | InChI=1S/C25H33NO4S/c1-18-15-26(16-19(2)30-18)23-12-8-20(9-13-23)14-24(27)22-10-6-21(7-11-22)17-31(28,29)25(3,4)5/h6-13,18-19H,14-17H2,1-5H3/t18-,19-/m1/s1 |
| InChIKey | TZTUDAFAJVBUOG-RTBURBONSA-N |
| XLogP | 4.44 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|