C26H35NO4S — CID 58143708
1-[4-(tert-butylsulfonylmethyl)phenyl]-2-[4-[(2R)-2-propan-2-ylmorpholin-4-yl]phenyl]ethanone (PubChem CID 58143708) has the molecular formula C26H35NO4S and a molecular weight of 457.64 g/mol. Its IUPAC name is 1-[4-(tert-butylsulfonylmethyl)phenyl]-2-[4-[(2R)-2-propan-2-ylmorpholin-4-yl]phenyl]ethanone.
| Compound Name | 1-[4-(tert-butylsulfonylmethyl)phenyl]-2-[4-[(2R)-2-propan-2-ylmorpholin-4-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 58143708 |
| Molecular Formula | C26H35NO4S |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 1-[4-(tert-butylsulfonylmethyl)phenyl]-2-[4-[(2R)-2-propan-2-ylmorpholin-4-yl]phenyl]ethanone |
| SMILES | CC(C)[C@@H]1CN(c2ccc(CC(=O)c3ccc(CS(=O)(=O)C(C)(C)C)cc3)cc2)CCO1 |
| InChI | InChI=1S/C26H35NO4S/c1-19(2)25-17-27(14-15-31-25)23-12-8-20(9-13-23)16-24(28)22-10-6-21(7-11-22)18-32(29,30)26(3,4)5/h6-13,19,25H,14-18H2,1-5H3/t25-/m0/s1 |
| InChIKey | MPZXSPXUXPBGHR-VWLOTQADSA-N |
| XLogP | 4.69 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|