C22H28O3S — CID 58144991
2-(4-tert-butylphenyl)-1-[4-(propan-2-ylsulfonylmethyl)phenyl]ethanone (PubChem CID 58144991) has the molecular formula C22H28O3S and a molecular weight of 372.53 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-1-[4-(propan-2-ylsulfonylmethyl)phenyl]ethanone.
| Compound Name | 2-(4-tert-butylphenyl)-1-[4-(propan-2-ylsulfonylmethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 58144991 |
| Molecular Formula | C22H28O3S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 2-(4-tert-butylphenyl)-1-[4-(propan-2-ylsulfonylmethyl)phenyl]ethanone |
| SMILES | CC(C)S(=O)(=O)Cc1ccc(C(=O)Cc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H28O3S/c1-16(2)26(24,25)15-18-6-10-19(11-7-18)21(23)14-17-8-12-20(13-9-17)22(3,4)5/h6-13,16H,14-15H2,1-5H3 |
| InChIKey | SMAKDBMHLNGGIW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |