C24H25NO4S — CID 10273860
[4-[4-[2-(4-tert-butylphenyl)acetyl]phenyl]phenyl] sulfamate (PubChem CID 10273860) has the molecular formula C24H25NO4S and a molecular weight of 423.53 g/mol. Its IUPAC name is [4-[4-[2-(4-tert-butylphenyl)acetyl]phenyl]phenyl] sulfamate.
| Compound Name | [4-[4-[2-(4-tert-butylphenyl)acetyl]phenyl]phenyl] sulfamate |
|---|---|
| PubChem CID | 10273860 |
| Molecular Formula | C24H25NO4S |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | [4-[4-[2-(4-tert-butylphenyl)acetyl]phenyl]phenyl] sulfamate |
| SMILES | CC(C)(C)c1ccc(CC(=O)c2ccc(-c3ccc(OS(N)(=O)=O)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H25NO4S/c1-24(2,3)21-12-4-17(5-13-21)16-23(26)20-8-6-18(7-9-20)19-10-14-22(15-11-19)29-30(25,27)28/h4-15H,16H2,1-3H3,(H2,25,27,28) |
| InChIKey | KTWBUMJNNIERFO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |