C33H30O8 — CID 58260459
[4-[2-(4-methoxycarbonyloxyphenyl)propan-2-yl]phenyl] [4-[2-(4-methoxyphenyl)-2-oxoethyl]phenyl] carbonate (PubChem CID 58260459) has the molecular formula C33H30O8 and a molecular weight of 554.60 g/mol. Its IUPAC name is [4-[2-(4-methoxycarbonyloxyphenyl)propan-2-yl]phenyl] [4-[2-(4-methoxyphenyl)-2-oxoethyl]phenyl] carbonate.
| Compound Name | [4-[2-(4-methoxycarbonyloxyphenyl)propan-2-yl]phenyl] [4-[2-(4-methoxyphenyl)-2-oxoethyl]phenyl] carbonate |
|---|---|
| PubChem CID | 58260459 |
| Molecular Formula | C33H30O8 |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | [4-[2-(4-methoxycarbonyloxyphenyl)propan-2-yl]phenyl] [4-[2-(4-methoxyphenyl)-2-oxoethyl]phenyl] carbonate |
| SMILES | COC(=O)Oc1ccc(C(C)(C)c2ccc(OC(=O)Oc3ccc(CC(=O)c4ccc(OC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H30O8/c1-33(2,24-9-17-28(18-10-24)39-31(35)38-4)25-11-19-29(20-12-25)41-32(36)40-27-13-5-22(6-14-27)21-30(34)23-7-15-26(37-3)16-8-23/h5-20H,21H2,1-4H3 |
| InChIKey | FGDGIBJSVKYFIB-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|