C22H28O3S — CID 58144720
1-[4-(tert-butylsulfonylmethyl)phenyl]-2-(4-propylphenyl)ethanone (PubChem CID 58144720) has the molecular formula C22H28O3S and a molecular weight of 372.53 g/mol. Its IUPAC name is 1-[4-(tert-butylsulfonylmethyl)phenyl]-2-(4-propylphenyl)ethanone.
| Compound Name | 1-[4-(tert-butylsulfonylmethyl)phenyl]-2-(4-propylphenyl)ethanone |
|---|---|
| PubChem CID | 58144720 |
| Molecular Formula | C22H28O3S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 1-[4-(tert-butylsulfonylmethyl)phenyl]-2-(4-propylphenyl)ethanone |
| SMILES | CCCc1ccc(CC(=O)c2ccc(CS(=O)(=O)C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H28O3S/c1-5-6-17-7-9-18(10-8-17)15-21(23)20-13-11-19(12-14-20)16-26(24,25)22(2,3)4/h7-14H,5-6,15-16H2,1-4H3 |
| InChIKey | IPSUINZSELXNKN-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |