C25H31NO4S — CID 58145128
N-[4-[2-oxo-2-[4-(propan-2-ylsulfonylmethyl)phenyl]ethyl]phenyl]cyclohexanecarboxamide (PubChem CID 58145128) has the molecular formula C25H31NO4S and a molecular weight of 441.59 g/mol. Its IUPAC name is N-[4-[2-oxo-2-[4-(propan-2-ylsulfonylmethyl)phenyl]ethyl]phenyl]cyclohexanecarboxamide.
| Compound Name | N-[4-[2-oxo-2-[4-(propan-2-ylsulfonylmethyl)phenyl]ethyl]phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 58145128 |
| Molecular Formula | C25H31NO4S |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | N-[4-[2-oxo-2-[4-(propan-2-ylsulfonylmethyl)phenyl]ethyl]phenyl]cyclohexanecarboxamide |
| SMILES | CC(C)S(=O)(=O)Cc1ccc(C(=O)Cc2ccc(NC(=O)C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C25H31NO4S/c1-18(2)31(29,30)17-20-8-12-21(13-9-20)24(27)16-19-10-14-23(15-11-19)26-25(28)22-6-4-3-5-7-22/h8-15,18,22H,3-7,16-17H2,1-2H3,(H,26,28) |
| InChIKey | RWEKFOOEHKYWSF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |