C23H28O4S — CID 58145169
2-(3-cyclopentyloxyphenyl)-1-[4-(propan-2-ylsulfonylmethyl)phenyl]ethanone (PubChem CID 58145169) has the molecular formula C23H28O4S and a molecular weight of 400.54 g/mol. Its IUPAC name is 2-(3-cyclopentyloxyphenyl)-1-[4-(propan-2-ylsulfonylmethyl)phenyl]ethanone.
| Compound Name | 2-(3-cyclopentyloxyphenyl)-1-[4-(propan-2-ylsulfonylmethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 58145169 |
| Molecular Formula | C23H28O4S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 2-(3-cyclopentyloxyphenyl)-1-[4-(propan-2-ylsulfonylmethyl)phenyl]ethanone |
| SMILES | CC(C)S(=O)(=O)Cc1ccc(C(=O)Cc2cccc(OC3CCCC3)c2)cc1 |
| InChI | InChI=1S/C23H28O4S/c1-17(2)28(25,26)16-18-10-12-20(13-11-18)23(24)15-19-6-5-9-22(14-19)27-21-7-3-4-8-21/h5-6,9-14,17,21H,3-4,7-8,15-16H2,1-2H3 |
| InChIKey | CMZXRQRWVSLAJG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |