C20H20O3S2 — CID 58144813
2-(1-benzothiophen-6-yl)-1-[4-(propan-2-ylsulfonylmethyl)phenyl]ethanone (PubChem CID 58144813) has the molecular formula C20H20O3S2 and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-(1-benzothiophen-6-yl)-1-[4-(propan-2-ylsulfonylmethyl)phenyl]ethanone.
| Compound Name | 2-(1-benzothiophen-6-yl)-1-[4-(propan-2-ylsulfonylmethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 58144813 |
| Molecular Formula | C20H20O3S2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 2-(1-benzothiophen-6-yl)-1-[4-(propan-2-ylsulfonylmethyl)phenyl]ethanone |
| SMILES | CC(C)S(=O)(=O)Cc1ccc(C(=O)Cc2ccc3ccsc3c2)cc1 |
| InChI | InChI=1S/C20H20O3S2/c1-14(2)25(22,23)13-15-3-6-17(7-4-15)19(21)11-16-5-8-18-9-10-24-20(18)12-16/h3-10,12,14H,11,13H2,1-2H3 |
| InChIKey | IVUILHYGXOYYGL-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |