C30H31NO5S — CID 58144723
5-[2-[4-(tert-butylsulfonylmethyl)phenyl]-2-oxoethyl]-2-(4-propan-2-ylphenyl)isoindole-1,3-dione (PubChem CID 58144723) has the molecular formula C30H31NO5S and a molecular weight of 517.65 g/mol. Its IUPAC name is 5-[2-[4-(tert-butylsulfonylmethyl)phenyl]-2-oxoethyl]-2-(4-propan-2-ylphenyl)isoindole-1,3-dione.
| Compound Name | 5-[2-[4-(tert-butylsulfonylmethyl)phenyl]-2-oxoethyl]-2-(4-propan-2-ylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 58144723 |
| Molecular Formula | C30H31NO5S |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | 5-[2-[4-(tert-butylsulfonylmethyl)phenyl]-2-oxoethyl]-2-(4-propan-2-ylphenyl)isoindole-1,3-dione |
| SMILES | CC(C)c1ccc(N2C(=O)c3ccc(CC(=O)c4ccc(CS(=O)(=O)C(C)(C)C)cc4)cc3C2=O)cc1 |
| InChI | InChI=1S/C30H31NO5S/c1-19(2)22-11-13-24(14-12-22)31-28(33)25-15-8-21(16-26(25)29(31)34)17-27(32)23-9-6-20(7-10-23)18-37(35,36)30(3,4)5/h6-16,19H,17-18H2,1-5H3 |
| InChIKey | JXEKIKYFKFVFEQ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|