C25H41NO4S — CID 59546376
ethyl 1-[4-(7-tert-butylsulfonylheptyl)phenyl]piperidine-4-carboxylate (PubChem CID 59546376) has the molecular formula C25H41NO4S and a molecular weight of 451.67 g/mol. Its IUPAC name is ethyl 1-[4-(7-tert-butylsulfonylheptyl)phenyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-(7-tert-butylsulfonylheptyl)phenyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 59546376 |
| Molecular Formula | C25H41NO4S |
| Molecular Weight | 451.67 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | ethyl 1-[4-(7-tert-butylsulfonylheptyl)phenyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ccc(CCCCCCCS(=O)(=O)C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C25H41NO4S/c1-5-30-24(27)22-16-18-26(19-17-22)23-14-12-21(13-15-23)11-9-7-6-8-10-20-31(28,29)25(2,3)4/h12-15,22H,5-11,16-20H2,1-4H3 |
| InChIKey | GNOYBGNLUQEMJF-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.67 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|