C20H25N3O5 — CID 168559108
ethyl 1-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]piperidine-4-carboxylate (PubChem CID 168559108) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is ethyl 1-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 168559108 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | ethyl 1-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ccc(NC3=CC(=O)N(CCO)C3=O)cc2)CC1 |
| InChI | InChI=1S/C20H25N3O5/c1-2-28-20(27)14-7-9-22(10-8-14)16-5-3-15(4-6-16)21-17-13-18(25)23(11-12-24)19(17)26/h3-6,13-14,21,24H,2,7-12H2,1H3 |
| InChIKey | ZKBMLSKUIJAFBJ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|