C21H29N3O4 — CID 108504241
ethyl 1-[2-oxo-2-(4-piperidin-1-ylanilino)acetyl]piperidine-4-carboxylate (PubChem CID 108504241) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is ethyl 1-[2-oxo-2-(4-piperidin-1-ylanilino)acetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-oxo-2-(4-piperidin-1-ylanilino)acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 108504241 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | ethyl 1-[2-oxo-2-(4-piperidin-1-ylanilino)acetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)C(=O)Nc2ccc(N3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C21H29N3O4/c1-2-28-21(27)16-10-14-24(15-11-16)20(26)19(25)22-17-6-8-18(9-7-17)23-12-4-3-5-13-23/h6-9,16H,2-5,10-15H2,1H3,(H,22,25) |
| InChIKey | ZVGVOMXHBGUDPL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|