C23H34N2O5S — CID 28632742
ethyl 1-[(3R)-1-(3-phenylpropylsulfonyl)piperidine-3-carbonyl]piperidine-4-carboxylate (PubChem CID 28632742) has the molecular formula C23H34N2O5S and a molecular weight of 450.60 g/mol. Its IUPAC name is ethyl 1-[(3R)-1-(3-phenylpropylsulfonyl)piperidine-3-carbonyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(3R)-1-(3-phenylpropylsulfonyl)piperidine-3-carbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 28632742 |
| Molecular Formula | C23H34N2O5S |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | ethyl 1-[(3R)-1-(3-phenylpropylsulfonyl)piperidine-3-carbonyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)[C@@H]2CCCN(S(=O)(=O)CCCc3ccccc3)C2)CC1 |
| InChI | InChI=1S/C23H34N2O5S/c1-2-30-23(27)20-12-15-24(16-13-20)22(26)21-11-6-14-25(18-21)31(28,29)17-7-10-19-8-4-3-5-9-19/h3-5,8-9,20-21H,2,6-7,10-18H2,1H3/t21-/m1/s1 |
| InChIKey | SVATVOPNRFIWFA-OAQYLSRUSA-N |
| XLogP | 2.46 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |