C26H35N3O3S — CID 28633070
(4-benzylpiperazin-1-yl)-[(3S)-1-(3-phenylpropylsulfonyl)piperidin-3-yl]methanone (PubChem CID 28633070) has the molecular formula C26H35N3O3S and a molecular weight of 469.65 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-[(3S)-1-(3-phenylpropylsulfonyl)piperidin-3-yl]methanone.
| Compound Name | (4-benzylpiperazin-1-yl)-[(3S)-1-(3-phenylpropylsulfonyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 28633070 |
| Molecular Formula | C26H35N3O3S |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-[(3S)-1-(3-phenylpropylsulfonyl)piperidin-3-yl]methanone |
| SMILES | O=C([C@H]1CCCN(S(=O)(=O)CCCc2ccccc2)C1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H35N3O3S/c30-26(28-18-16-27(17-19-28)21-24-11-5-2-6-12-24)25-14-7-15-29(22-25)33(31,32)20-8-13-23-9-3-1-4-10-23/h1-6,9-12,25H,7-8,13-22H2/t25-/m0/s1 |
| InChIKey | FOUOFADVGMLDLT-VWLOTQADSA-N |
| XLogP | 3.01 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |