C21H31N3O4S — CID 92675959
1-[(3R)-1-(3-phenylpropylsulfonyl)piperidine-3-carbonyl]piperidine-4-carboxamide (PubChem CID 92675959) has the molecular formula C21H31N3O4S and a molecular weight of 421.56 g/mol. Its IUPAC name is 1-[(3R)-1-(3-phenylpropylsulfonyl)piperidine-3-carbonyl]piperidine-4-carboxamide.
| Compound Name | 1-[(3R)-1-(3-phenylpropylsulfonyl)piperidine-3-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 92675959 |
| Molecular Formula | C21H31N3O4S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 1-[(3R)-1-(3-phenylpropylsulfonyl)piperidine-3-carbonyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)[C@@H]2CCCN(S(=O)(=O)CCCc3ccccc3)C2)CC1 |
| InChI | InChI=1S/C21H31N3O4S/c22-20(25)18-10-13-23(14-11-18)21(26)19-9-4-12-24(16-19)29(27,28)15-5-8-17-6-2-1-3-7-17/h1-3,6-7,18-19H,4-5,8-16H2,(H2,22,25)/t19-/m1/s1 |
| InChIKey | QQNDOXQKGUZFEM-LJQANCHMSA-N |
| XLogP | 1.38 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |