C20H30N2O3S — CID 38015366
[(3R)-1-(3-phenylpropylsulfonyl)piperidin-3-yl]-piperidin-1-ylmethanone (PubChem CID 38015366) has the molecular formula C20H30N2O3S and a molecular weight of 378.54 g/mol. Its IUPAC name is [(3R)-1-(3-phenylpropylsulfonyl)piperidin-3-yl]-piperidin-1-ylmethanone.
| Compound Name | [(3R)-1-(3-phenylpropylsulfonyl)piperidin-3-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 38015366 |
| Molecular Formula | C20H30N2O3S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | [(3R)-1-(3-phenylpropylsulfonyl)piperidin-3-yl]-piperidin-1-ylmethanone |
| SMILES | O=C([C@@H]1CCCN(S(=O)(=O)CCCc2ccccc2)C1)N1CCCCC1 |
| InChI | InChI=1S/C20H30N2O3S/c23-20(21-13-5-2-6-14-21)19-12-7-15-22(17-19)26(24,25)16-8-11-18-9-3-1-4-10-18/h1,3-4,9-10,19H,2,5-8,11-17H2/t19-/m1/s1 |
| InChIKey | BHVRHIGHARCYCF-LJQANCHMSA-N |
| XLogP | 2.67 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |