C25H32FN3O3S — CID 43910492
[4-(2-fluorophenyl)piperazin-1-yl]-[1-(3-phenylpropylsulfonyl)piperidin-3-yl]methanone (PubChem CID 43910492) has the molecular formula C25H32FN3O3S and a molecular weight of 473.61 g/mol. Its IUPAC name is [4-(2-fluorophenyl)piperazin-1-yl]-[1-(3-phenylpropylsulfonyl)piperidin-3-yl]methanone.
| Compound Name | [4-(2-fluorophenyl)piperazin-1-yl]-[1-(3-phenylpropylsulfonyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 43910492 |
| Molecular Formula | C25H32FN3O3S |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | [4-(2-fluorophenyl)piperazin-1-yl]-[1-(3-phenylpropylsulfonyl)piperidin-3-yl]methanone |
| SMILES | O=C(C1CCCN(S(=O)(=O)CCCc2ccccc2)C1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C25H32FN3O3S/c26-23-12-4-5-13-24(23)27-15-17-28(18-16-27)25(30)22-11-6-14-29(20-22)33(31,32)19-7-10-21-8-2-1-3-9-21/h1-5,8-9,12-13,22H,6-7,10-11,14-20H2 |
| InChIKey | UGUYFFULZMCGLC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |