C21H24F2N2O3S — CID 28579455
(3S)-N-(2,6-difluorophenyl)-1-(3-phenylpropylsulfonyl)piperidine-3-carboxamide (PubChem CID 28579455) has the molecular formula C21H24F2N2O3S and a molecular weight of 422.50 g/mol. Its IUPAC name is (3S)-N-(2,6-difluorophenyl)-1-(3-phenylpropylsulfonyl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-(2,6-difluorophenyl)-1-(3-phenylpropylsulfonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 28579455 |
| Molecular Formula | C21H24F2N2O3S |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | (3S)-N-(2,6-difluorophenyl)-1-(3-phenylpropylsulfonyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1c(F)cccc1F)[C@H]1CCCN(S(=O)(=O)CCCc2ccccc2)C1 |
| InChI | InChI=1S/C21H24F2N2O3S/c22-18-11-4-12-19(23)20(18)24-21(26)17-10-5-13-25(15-17)29(27,28)14-6-9-16-7-2-1-3-8-16/h1-4,7-8,11-12,17H,5-6,9-10,13-15H2,(H,24,26)/t17-/m0/s1 |
| InChIKey | XRJHYXKJRAZEMM-KRWDZBQOSA-N |
| XLogP | 3.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |