C27H31N3O5S2 — CID 94864145
(3R)-1-(3-phenylpropylsulfonyl)-N-[4-(phenylsulfamoyl)phenyl]piperidine-3-carboxamide (PubChem CID 94864145) has the molecular formula C27H31N3O5S2 and a molecular weight of 541.70 g/mol. Its IUPAC name is (3R)-1-(3-phenylpropylsulfonyl)-N-[4-(phenylsulfamoyl)phenyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-(3-phenylpropylsulfonyl)-N-[4-(phenylsulfamoyl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94864145 |
| Molecular Formula | C27H31N3O5S2 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | (3R)-1-(3-phenylpropylsulfonyl)-N-[4-(phenylsulfamoyl)phenyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ccccc2)cc1)[C@@H]1CCCN(S(=O)(=O)CCCc2ccccc2)C1 |
| InChI | InChI=1S/C27H31N3O5S2/c31-27(28-24-15-17-26(18-16-24)37(34,35)29-25-13-5-2-6-14-25)23-12-7-19-30(21-23)36(32,33)20-8-11-22-9-3-1-4-10-22/h1-6,9-10,13-18,23,29H,7-8,11-12,19-21H2,(H,28,31)/t23-/m1/s1 |
| InChIKey | BXHWQJQOCTZGOX-HSZRJFAPSA-N |
| XLogP | 4.10 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |