C24H31FN2O3S — CID 28632952
(3R)-N-[3-(4-fluorophenyl)propyl]-1-(3-phenylpropylsulfonyl)piperidine-3-carboxamide (PubChem CID 28632952) has the molecular formula C24H31FN2O3S and a molecular weight of 446.59 g/mol. Its IUPAC name is (3R)-N-[3-(4-fluorophenyl)propyl]-1-(3-phenylpropylsulfonyl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-[3-(4-fluorophenyl)propyl]-1-(3-phenylpropylsulfonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 28632952 |
| Molecular Formula | C24H31FN2O3S |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | (3R)-N-[3-(4-fluorophenyl)propyl]-1-(3-phenylpropylsulfonyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCCc1ccc(F)cc1)[C@@H]1CCCN(S(=O)(=O)CCCc2ccccc2)C1 |
| InChI | InChI=1S/C24H31FN2O3S/c25-23-14-12-21(13-15-23)9-4-16-26-24(28)22-11-5-17-27(19-22)31(29,30)18-6-10-20-7-2-1-3-8-20/h1-3,7-8,12-15,22H,4-6,9-11,16-19H2,(H,26,28)/t22-/m1/s1 |
| InChIKey | QRFVMSJCXZWTFP-JOCHJYFZSA-N |
| XLogP | 3.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|