C26H35N3O3S — CID 92675182
(3S)-N-[3-(2,3-dihydroindol-1-yl)propyl]-1-(3-phenylpropylsulfonyl)piperidine-3-carboxamide (PubChem CID 92675182) has the molecular formula C26H35N3O3S and a molecular weight of 469.65 g/mol. Its IUPAC name is (3S)-N-[3-(2,3-dihydroindol-1-yl)propyl]-1-(3-phenylpropylsulfonyl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-[3-(2,3-dihydroindol-1-yl)propyl]-1-(3-phenylpropylsulfonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92675182 |
| Molecular Formula | C26H35N3O3S |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | (3S)-N-[3-(2,3-dihydroindol-1-yl)propyl]-1-(3-phenylpropylsulfonyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCCN1CCc2ccccc21)[C@H]1CCCN(S(=O)(=O)CCCc2ccccc2)C1 |
| InChI | InChI=1S/C26H35N3O3S/c30-26(27-16-8-17-28-19-15-23-12-4-5-14-25(23)28)24-13-6-18-29(21-24)33(31,32)20-7-11-22-9-2-1-3-10-22/h1-5,9-10,12,14,24H,6-8,11,13,15-21H2,(H,27,30)/t24-/m0/s1 |
| InChIKey | LCSWVVSSSDYZID-DEOSSOPVSA-N |
| XLogP | 3.23 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|