C27H45NO3S — CID 158497736
(2S,6R)-2,6-dimethyl-4-[4-[2-[4-(3-methylpentan-3-ylsulfonylmethyl)cyclohexyl]ethyl]phenyl]morpholine (PubChem CID 158497736) has the molecular formula C27H45NO3S and a molecular weight of 463.73 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethyl-4-[4-[2-[4-(3-methylpentan-3-ylsulfonylmethyl)cyclohexyl]ethyl]phenyl]morpholine.
| Compound Name | (2S,6R)-2,6-dimethyl-4-[4-[2-[4-(3-methylpentan-3-ylsulfonylmethyl)cyclohexyl]ethyl]phenyl]morpholine |
|---|---|
| PubChem CID | 158497736 |
| Molecular Formula | C27H45NO3S |
| Molecular Weight | 463.73 g/mol |
| Exact Mass | 463.31 |
| IUPAC Name | (2S,6R)-2,6-dimethyl-4-[4-[2-[4-(3-methylpentan-3-ylsulfonylmethyl)cyclohexyl]ethyl]phenyl]morpholine |
| SMILES | CCC(C)(CC)S(=O)(=O)CC1CCC(CCc2ccc(N3C[C@@H](C)O[C@@H](C)C3)cc2)CC1 |
| InChI | InChI=1S/C27H45NO3S/c1-6-27(5,7-2)32(29,30)20-25-12-10-23(11-13-25)8-9-24-14-16-26(17-15-24)28-18-21(3)31-22(4)19-28/h14-17,21-23,25H,6-13,18-20H2,1-5H3/t21-,22+,23?,25? |
| InChIKey | KMFHEEKLNCXRMD-PMLGBOFDSA-N |
| XLogP | 6.03 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.73 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|