C24H38O3S — CID 158591011
4-[4-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethyl]phenyl]oxane (PubChem CID 158591011) has the molecular formula C24H38O3S and a molecular weight of 406.63 g/mol. Its IUPAC name is 4-[4-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethyl]phenyl]oxane.
| Compound Name | 4-[4-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethyl]phenyl]oxane |
|---|---|
| PubChem CID | 158591011 |
| Molecular Formula | C24H38O3S |
| Molecular Weight | 406.63 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 4-[4-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethyl]phenyl]oxane |
| SMILES | CC(C)(C)S(=O)(=O)CC1CCC(CCc2ccc(C3CCOCC3)cc2)CC1 |
| InChI | InChI=1S/C24H38O3S/c1-24(2,3)28(25,26)18-21-8-6-19(7-9-21)4-5-20-10-12-22(13-11-20)23-14-16-27-17-15-23/h10-13,19,21,23H,4-9,14-18H2,1-3H3 |
| InChIKey | IHDPRKFEJLYSJT-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.63 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |