C19H28O2 — CID 67980435
2-[4-[2-(4-ethylcyclohexyl)ethyl]phenyl]-1,3-dioxolane (PubChem CID 67980435) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is 2-[4-[2-(4-ethylcyclohexyl)ethyl]phenyl]-1,3-dioxolane.
| Compound Name | 2-[4-[2-(4-ethylcyclohexyl)ethyl]phenyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 67980435 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 2-[4-[2-(4-ethylcyclohexyl)ethyl]phenyl]-1,3-dioxolane |
| SMILES | CCC1CCC(CCc2ccc(C3OCCO3)cc2)CC1 |
| InChI | InChI=1S/C19H28O2/c1-2-15-3-5-16(6-4-15)7-8-17-9-11-18(12-10-17)19-20-13-14-21-19/h9-12,15-16,19H,2-8,13-14H2,1H3 |
| InChIKey | QMYDWJBPFVHIKN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |