C21H30O2S2 — CID 59546154
6-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethyl]-1-benzothiophene (PubChem CID 59546154) has the molecular formula C21H30O2S2 and a molecular weight of 378.60 g/mol. Its IUPAC name is 6-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethyl]-1-benzothiophene.
| Compound Name | 6-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethyl]-1-benzothiophene |
|---|---|
| PubChem CID | 59546154 |
| Molecular Formula | C21H30O2S2 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 6-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethyl]-1-benzothiophene |
| SMILES | CC(C)(C)S(=O)(=O)CC1CCC(CCc2ccc3ccsc3c2)CC1 |
| InChI | InChI=1S/C21H30O2S2/c1-21(2,3)25(22,23)15-18-8-5-16(6-9-18)4-7-17-10-11-19-12-13-24-20(19)14-17/h10-14,16,18H,4-9,15H2,1-3H3 |
| InChIKey | CDWFXRYBKRVVSO-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |