C14H17NO2S — CID 151477380
[4-(1-benzothiophen-6-yl)-2-methylbutan-2-yl] carbamate (PubChem CID 151477380) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is [4-(1-benzothiophen-6-yl)-2-methylbutan-2-yl] carbamate.
| Compound Name | [4-(1-benzothiophen-6-yl)-2-methylbutan-2-yl] carbamate |
|---|---|
| PubChem CID | 151477380 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | [4-(1-benzothiophen-6-yl)-2-methylbutan-2-yl] carbamate |
| SMILES | CC(C)(CCc1ccc2ccsc2c1)OC(N)=O |
| InChI | InChI=1S/C14H17NO2S/c1-14(2,17-13(15)16)7-5-10-3-4-11-6-8-18-12(11)9-10/h3-4,6,8-9H,5,7H2,1-2H3,(H2,15,16) |
| InChIKey | PLSVYLIDCGJWOE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |