C11H11NOS2 — CID 163420802
S-methyl N-(1-benzothiophen-6-ylmethyl)carbamothioate (PubChem CID 163420802) has the molecular formula C11H11NOS2 and a molecular weight of 237.35 g/mol. Its IUPAC name is S-methyl N-(1-benzothiophen-6-ylmethyl)carbamothioate.
| Compound Name | S-methyl N-(1-benzothiophen-6-ylmethyl)carbamothioate |
|---|---|
| PubChem CID | 163420802 |
| Molecular Formula | C11H11NOS2 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | S-methyl N-(1-benzothiophen-6-ylmethyl)carbamothioate |
| SMILES | CSC(=O)NCc1ccc2ccsc2c1 |
| InChI | InChI=1S/C11H11NOS2/c1-14-11(13)12-7-8-2-3-9-4-5-15-10(9)6-8/h2-6H,7H2,1H3,(H,12,13) |
| InChIKey | AIGPALMOFKXGTL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|