C13H17NS — CID 166940972
1-(1-benzothiophen-6-yl)-N-methylbutan-2-amine (PubChem CID 166940972) has the molecular formula C13H17NS and a molecular weight of 219.35 g/mol. Its IUPAC name is 1-(1-benzothiophen-6-yl)-N-methylbutan-2-amine.
| Compound Name | 1-(1-benzothiophen-6-yl)-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 166940972 |
| Molecular Formula | C13H17NS |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 1-(1-benzothiophen-6-yl)-N-methylbutan-2-amine |
| SMILES | CCC(Cc1ccc2ccsc2c1)NC |
| InChI | InChI=1S/C13H17NS/c1-3-12(14-2)8-10-4-5-11-6-7-15-13(11)9-10/h4-7,9,12,14H,3,8H2,1-2H3 |
| InChIKey | GTSBBRHQKIGZDN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |