C20H16N2OS3 — CID 74762753
N-(1-benzothiophen-5-ylmethyl)-8-(methyldisulfanyl)quinoline-5-carboxamide (PubChem CID 74762753) has the molecular formula C20H16N2OS3 and a molecular weight of 396.56 g/mol. Its IUPAC name is N-(1-benzothiophen-5-ylmethyl)-8-(methyldisulfanyl)quinoline-5-carboxamide.
| Compound Name | N-(1-benzothiophen-5-ylmethyl)-8-(methyldisulfanyl)quinoline-5-carboxamide |
|---|---|
| PubChem CID | 74762753 |
| Molecular Formula | C20H16N2OS3 |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | N-(1-benzothiophen-5-ylmethyl)-8-(methyldisulfanyl)quinoline-5-carboxamide |
| SMILES | CSSc1ccc(C(=O)NCc2ccc3sccc3c2)c2cccnc12 |
| InChI | InChI=1S/C20H16N2OS3/c1-24-26-18-7-5-16(15-3-2-9-21-19(15)18)20(23)22-12-13-4-6-17-14(11-13)8-10-25-17/h2-11H,12H2,1H3,(H,22,23) |
| InChIKey | XIZYYFUGFJPKQV-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|