C19H16N4OS2 — CID 74762755
N-(1H-indazol-5-ylmethyl)-8-(methyldisulfanyl)quinoline-5-carboxamide (PubChem CID 74762755) has the molecular formula C19H16N4OS2 and a molecular weight of 380.50 g/mol. Its IUPAC name is N-(1H-indazol-5-ylmethyl)-8-(methyldisulfanyl)quinoline-5-carboxamide.
| Compound Name | N-(1H-indazol-5-ylmethyl)-8-(methyldisulfanyl)quinoline-5-carboxamide |
|---|---|
| PubChem CID | 74762755 |
| Molecular Formula | C19H16N4OS2 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | N-(1H-indazol-5-ylmethyl)-8-(methyldisulfanyl)quinoline-5-carboxamide |
| SMILES | CSSc1ccc(C(=O)NCc2ccc3[nH]ncc3c2)c2cccnc12 |
| InChI | InChI=1S/C19H16N4OS2/c1-25-26-17-7-5-15(14-3-2-8-20-18(14)17)19(24)21-10-12-4-6-16-13(9-12)11-22-23-16/h2-9,11H,10H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | JBLGQFVUOVXKPG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|