C21H20N4O2S2 — CID 74762823
N-[(1-carbamoyl-2,3-dihydroindol-2-yl)methyl]-8-(methyldisulfanyl)quinoline-5-carboxamide (PubChem CID 74762823) has the molecular formula C21H20N4O2S2 and a molecular weight of 424.55 g/mol. Its IUPAC name is N-[(1-carbamoyl-2,3-dihydroindol-2-yl)methyl]-8-(methyldisulfanyl)quinoline-5-carboxamide.
| Compound Name | N-[(1-carbamoyl-2,3-dihydroindol-2-yl)methyl]-8-(methyldisulfanyl)quinoline-5-carboxamide |
|---|---|
| PubChem CID | 74762823 |
| Molecular Formula | C21H20N4O2S2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | N-[(1-carbamoyl-2,3-dihydroindol-2-yl)methyl]-8-(methyldisulfanyl)quinoline-5-carboxamide |
| SMILES | CSSc1ccc(C(=O)NCC2Cc3ccccc3N2C(N)=O)c2cccnc12 |
| InChI | InChI=1S/C21H20N4O2S2/c1-28-29-18-9-8-16(15-6-4-10-23-19(15)18)20(26)24-12-14-11-13-5-2-3-7-17(13)25(14)21(22)27/h2-10,14H,11-12H2,1H3,(H2,22,27)(H,24,26) |
| InChIKey | UXPNNRWBGPIUJG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|